C20H22FN3O — CID 30857317
(E)-3-(2-fluorophenyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]prop-2-enamide (PubChem CID 30857317) has the molecular formula C20H22FN3O and a molecular weight of 339.41 g/mol. Its IUPAC name is (E)-3-(2-fluorophenyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2-fluorophenyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 30857317 |
| Molecular Formula | C20H22FN3O |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (E)-3-(2-fluorophenyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]prop-2-enamide |
| SMILES | CN1CCN(c2ccc(NC(=O)/C=C/c3ccccc3F)cc2)CC1 |
| InChI | InChI=1S/C20H22FN3O/c1-23-12-14-24(15-13-23)18-9-7-17(8-10-18)22-20(25)11-6-16-4-2-3-5-19(16)21/h2-11H,12-15H2,1H3,(H,22,25)/b11-6+ |
| InChIKey | XPBFRFBDQHYKAT-IZZDOVSWSA-N |
| XLogP | 3.23 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|