C32H34F2N4O2 — CID 171683981
(E)-3-(2,4-difluorophenyl)-N-[4-[1-[4-(4-methylpiperazin-1-yl)benzoyl]piperidin-4-yl]phenyl]prop-2-enamide (PubChem CID 171683981) has the molecular formula C32H34F2N4O2 and a molecular weight of 544.65 g/mol. Its IUPAC name is (E)-3-(2,4-difluorophenyl)-N-[4-[1-[4-(4-methylpiperazin-1-yl)benzoyl]piperidin-4-yl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-difluorophenyl)-N-[4-[1-[4-(4-methylpiperazin-1-yl)benzoyl]piperidin-4-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 171683981 |
| Molecular Formula | C32H34F2N4O2 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | (E)-3-(2,4-difluorophenyl)-N-[4-[1-[4-(4-methylpiperazin-1-yl)benzoyl]piperidin-4-yl]phenyl]prop-2-enamide |
| SMILES | CN1CCN(c2ccc(C(=O)N3CCC(c4ccc(NC(=O)/C=C/c5ccc(F)cc5F)cc4)CC3)cc2)CC1 |
| InChI | InChI=1S/C32H34F2N4O2/c1-36-18-20-37(21-19-36)29-11-5-26(6-12-29)32(40)38-16-14-24(15-17-38)23-3-9-28(10-4-23)35-31(39)13-7-25-2-8-27(33)22-30(25)34/h2-13,22,24H,14-21H2,1H3,(H,35,39)/b13-7+ |
| InChIKey | SMXDPYRQRSNQBH-NTUHNPAUSA-N |
| XLogP | 5.39 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|