C28H36FN5O2 — CID 163230013
[3-fluoro-4-hydroxy-5-[(4-methylpiperazin-1-yl)iminomethyl]phenyl]-[4-(4-pyrrolidin-1-ylphenyl)piperidin-1-yl]methanone (PubChem CID 163230013) has the molecular formula C28H36FN5O2 and a molecular weight of 493.63 g/mol. Its IUPAC name is [3-fluoro-4-hydroxy-5-[(4-methylpiperazin-1-yl)iminomethyl]phenyl]-[4-(4-pyrrolidin-1-ylphenyl)piperidin-1-yl]methanone.
| Compound Name | [3-fluoro-4-hydroxy-5-[(4-methylpiperazin-1-yl)iminomethyl]phenyl]-[4-(4-pyrrolidin-1-ylphenyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 163230013 |
| Molecular Formula | C28H36FN5O2 |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | [3-fluoro-4-hydroxy-5-[(4-methylpiperazin-1-yl)iminomethyl]phenyl]-[4-(4-pyrrolidin-1-ylphenyl)piperidin-1-yl]methanone |
| SMILES | CN1CCN(N=Cc2cc(C(=O)N3CCC(c4ccc(N5CCCC5)cc4)CC3)cc(F)c2O)CC1 |
| InChI | InChI=1S/C28H36FN5O2/c1-31-14-16-34(17-15-31)30-20-24-18-23(19-26(29)27(24)35)28(36)33-12-8-22(9-13-33)21-4-6-25(7-5-21)32-10-2-3-11-32/h4-7,18-20,22,35H,2-3,8-17H2,1H3 |
| InChIKey | LEZNYGQGMZHAKH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 62.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|