C22H23FN2O3 — CID 163230160
3-fluoro-2-hydroxy-5-[3-(4-pyrrolidin-1-ylphenyl)pyrrolidine-1-carbonyl]benzaldehyde (PubChem CID 163230160) has the molecular formula C22H23FN2O3 and a molecular weight of 382.44 g/mol. Its IUPAC name is 3-fluoro-2-hydroxy-5-[3-(4-pyrrolidin-1-ylphenyl)pyrrolidine-1-carbonyl]benzaldehyde.
| Compound Name | 3-fluoro-2-hydroxy-5-[3-(4-pyrrolidin-1-ylphenyl)pyrrolidine-1-carbonyl]benzaldehyde |
|---|---|
| PubChem CID | 163230160 |
| Molecular Formula | C22H23FN2O3 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 3-fluoro-2-hydroxy-5-[3-(4-pyrrolidin-1-ylphenyl)pyrrolidine-1-carbonyl]benzaldehyde |
| SMILES | O=Cc1cc(C(=O)N2CCC(c3ccc(N4CCCC4)cc3)C2)cc(F)c1O |
| InChI | InChI=1S/C22H23FN2O3/c23-20-12-17(11-18(14-26)21(20)27)22(28)25-10-7-16(13-25)15-3-5-19(6-4-15)24-8-1-2-9-24/h3-6,11-12,14,16,27H,1-2,7-10,13H2 |
| InChIKey | YMEXYFPTOANDTG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|