C22H25FN2O4S — CID 163230266
3-fluoro-2-hydroxy-5-[4-(4-pyrrolidin-1-ylphenyl)piperidin-1-yl]sulfonylbenzaldehyde (PubChem CID 163230266) has the molecular formula C22H25FN2O4S and a molecular weight of 432.52 g/mol. Its IUPAC name is 3-fluoro-2-hydroxy-5-[4-(4-pyrrolidin-1-ylphenyl)piperidin-1-yl]sulfonylbenzaldehyde.
| Compound Name | 3-fluoro-2-hydroxy-5-[4-(4-pyrrolidin-1-ylphenyl)piperidin-1-yl]sulfonylbenzaldehyde |
|---|---|
| PubChem CID | 163230266 |
| Molecular Formula | C22H25FN2O4S |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 3-fluoro-2-hydroxy-5-[4-(4-pyrrolidin-1-ylphenyl)piperidin-1-yl]sulfonylbenzaldehyde |
| SMILES | O=Cc1cc(S(=O)(=O)N2CCC(c3ccc(N4CCCC4)cc3)CC2)cc(F)c1O |
| InChI | InChI=1S/C22H25FN2O4S/c23-21-14-20(13-18(15-26)22(21)27)30(28,29)25-11-7-17(8-12-25)16-3-5-19(6-4-16)24-9-1-2-10-24/h3-6,13-15,17,27H,1-2,7-12H2 |
| InChIKey | HRYGGUBGHKMQQN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|