C24H29F2N3O4S — CID 55917517
[1-(3,4-difluorophenyl)sulfonylpiperidin-4-yl]-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methanone (PubChem CID 55917517) has the molecular formula C24H29F2N3O4S and a molecular weight of 493.58 g/mol. Its IUPAC name is [1-(3,4-difluorophenyl)sulfonylpiperidin-4-yl]-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | [1-(3,4-difluorophenyl)sulfonylpiperidin-4-yl]-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 55917517 |
| Molecular Formula | C24H29F2N3O4S |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | [1-(3,4-difluorophenyl)sulfonylpiperidin-4-yl]-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methanone |
| SMILES | COc1ccc(N2CCCN(C(=O)C3CCN(S(=O)(=O)c4ccc(F)c(F)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C24H29F2N3O4S/c1-33-20-5-3-19(4-6-20)27-11-2-12-28(16-15-27)24(30)18-9-13-29(14-10-18)34(31,32)21-7-8-22(25)23(26)17-21/h3-8,17-18H,2,9-16H2,1H3 |
| InChIKey | NGOVLEDZEYCUDG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|