C19H20FNO2 — CID 167254120
3-fluoro-2-hydroxy-5-[2-(3-pyrrolidin-1-ylphenyl)ethyl]benzaldehyde (PubChem CID 167254120) has the molecular formula C19H20FNO2 and a molecular weight of 313.37 g/mol. Its IUPAC name is 3-fluoro-2-hydroxy-5-[2-(3-pyrrolidin-1-ylphenyl)ethyl]benzaldehyde.
| Compound Name | 3-fluoro-2-hydroxy-5-[2-(3-pyrrolidin-1-ylphenyl)ethyl]benzaldehyde |
|---|---|
| PubChem CID | 167254120 |
| Molecular Formula | C19H20FNO2 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 3-fluoro-2-hydroxy-5-[2-(3-pyrrolidin-1-ylphenyl)ethyl]benzaldehyde |
| SMILES | O=Cc1cc(CCc2cccc(N3CCCC3)c2)cc(F)c1O |
| InChI | InChI=1S/C19H20FNO2/c20-18-12-15(10-16(13-22)19(18)23)7-6-14-4-3-5-17(11-14)21-8-1-2-9-21/h3-5,10-13,23H,1-2,6-9H2 |
| InChIKey | PPLRFQBIDKCPPO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|