C23H25FN2O5S — CID 163230423
3-fluoro-2-hydroxy-5-[4-(4-pyrrolidin-1-ylphenyl)sulfonylpiperidine-1-carbonyl]benzaldehyde (PubChem CID 163230423) has the molecular formula C23H25FN2O5S and a molecular weight of 460.53 g/mol. Its IUPAC name is 3-fluoro-2-hydroxy-5-[4-(4-pyrrolidin-1-ylphenyl)sulfonylpiperidine-1-carbonyl]benzaldehyde.
| Compound Name | 3-fluoro-2-hydroxy-5-[4-(4-pyrrolidin-1-ylphenyl)sulfonylpiperidine-1-carbonyl]benzaldehyde |
|---|---|
| PubChem CID | 163230423 |
| Molecular Formula | C23H25FN2O5S |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 3-fluoro-2-hydroxy-5-[4-(4-pyrrolidin-1-ylphenyl)sulfonylpiperidine-1-carbonyl]benzaldehyde |
| SMILES | O=Cc1cc(C(=O)N2CCC(S(=O)(=O)c3ccc(N4CCCC4)cc3)CC2)cc(F)c1O |
| InChI | InChI=1S/C23H25FN2O5S/c24-21-14-16(13-17(15-27)22(21)28)23(29)26-11-7-20(8-12-26)32(30,31)19-5-3-18(4-6-19)25-9-1-2-10-25/h3-6,13-15,20,28H,1-2,7-12H2 |
| InChIKey | BUVRWRWLAMPMBM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|