4-[(6-chloro-1,3-benzothiazol-2-yl)amino]-3-methylbenzoic acid

C15H11ClN2O2S — CID 63527636

IUPAC4-[(6-chloro-1,3-benzothiazol-2-yl)amino]-3-methylbenzoic acid
SMILESCc1cc(C(=O)O)ccc1Nc1nc2ccc(Cl)cc2s1
InChIInChI=1S/C15H11ClN2O2S/c1-8-6-9(14(19)20)2-4-11(8)17-15-18-12-5-3-10(16)7-13(12)21-15/h2-7H,1H3,(H,17,18)(H,19,20)
InChIKeyQJSUHBTVVJNKGH-UHFFFAOYSA-N
MW318.79 g/mol
LogP4.70
Rot. Bonds3

About 4-[(6-chloro-1,3-benzothiazol-2-yl)amino]-3-methylbenzoic acid

4-[(6-chloro-1,3-benzothiazol-2-yl)amino]-3-methylbenzoic acid (PubChem CID 63527636) has the molecular formula C15H11ClN2O2S and a molecular weight of 318.79 g/mol. Its IUPAC name is 4-[(6-chloro-1,3-benzothiazol-2-yl)amino]-3-methylbenzoic acid.

Molecular Properties

Compound Name4-[(6-chloro-1,3-benzothiazol-2-yl)amino]-3-methylbenzoic acid
PubChem CID63527636
Molecular FormulaC15H11ClN2O2S
Molecular Weight318.79 g/mol
Exact Mass318.02
IUPAC Name4-[(6-chloro-1,3-benzothiazol-2-yl)amino]-3-methylbenzoic acid
SMILESCc1cc(C(=O)O)ccc1Nc1nc2ccc(Cl)cc2s1
InChIInChI=1S/C15H11ClN2O2S/c1-8-6-9(14(19)20)2-4-11(8)17-15-18-12-5-3-10(16)7-13(12)21-15/h2-7H,1H3,(H,17,18)(H,19,20)
InChIKeyQJSUHBTVVJNKGH-UHFFFAOYSA-N
XLogP4.70
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500318.79
LogP ≤ 54.70
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-[(6-chloro-1,3-benzothiazol-2-yl)amino]-3-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(6-chloro-1,3-benzothiazol-2-yl)amino]-3-methylbenzoic acid?
The IUPAC name of 4-[(6-chloro-1,3-benzothiazol-2-yl)amino]-3-methylbenzoic acid (CID 63527636) is 4-[(6-chloro-1,3-benzothiazol-2-yl)amino]-3-methylbenzoic acid.
What is the SMILES notation for 4-[(6-chloro-1,3-benzothiazol-2-yl)amino]-3-methylbenzoic acid?
The canonical SMILES for 4-[(6-chloro-1,3-benzothiazol-2-yl)amino]-3-methylbenzoic acid is Cc1cc(C(=O)O)ccc1Nc1nc2ccc(Cl)cc2s1.
What is the InChIKey of 4-[(6-chloro-1,3-benzothiazol-2-yl)amino]-3-methylbenzoic acid?
The InChIKey is QJSUHBTVVJNKGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11ClN2O2S/c1-8-6-9(14(19)20)2-4-11(8)17-15-18-12-5-3-10(16)7-13(12)21-15/h2-7H,1H3,(H,17,18)(H,19,20).
What are the key properties of 4-[(6-chloro-1,3-benzothiazol-2-yl)amino]-3-methylbenzoic acid?
4-[(6-chloro-1,3-benzothiazol-2-yl)amino]-3-methylbenzoic acid has a molecular weight of 318.79 g/mol, XLogP of 4.70, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(6-chloro-1,3-benzothiazol-2-yl)amino]-3-methylbenzoic acid is sourced from PubChem (CID 63527636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).