C15H11ClN2O2S — CID 63527636
4-[(6-chloro-1,3-benzothiazol-2-yl)amino]-3-methylbenzoic acid (PubChem CID 63527636) has the molecular formula C15H11ClN2O2S and a molecular weight of 318.79 g/mol. Its IUPAC name is 4-[(6-chloro-1,3-benzothiazol-2-yl)amino]-3-methylbenzoic acid.
| Compound Name | 4-[(6-chloro-1,3-benzothiazol-2-yl)amino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 63527636 |
| Molecular Formula | C15H11ClN2O2S |
| Molecular Weight | 318.79 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 4-[(6-chloro-1,3-benzothiazol-2-yl)amino]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1Nc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C15H11ClN2O2S/c1-8-6-9(14(19)20)2-4-11(8)17-15-18-12-5-3-10(16)7-13(12)21-15/h2-7H,1H3,(H,17,18)(H,19,20) |
| InChIKey | QJSUHBTVVJNKGH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.79 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |