C14H11ClN4OS — CID 82775308
4-amino-3-[(6-chloro-1,3-benzothiazol-2-yl)amino]benzamide (PubChem CID 82775308) has the molecular formula C14H11ClN4OS and a molecular weight of 318.79 g/mol. Its IUPAC name is 4-amino-3-[(6-chloro-1,3-benzothiazol-2-yl)amino]benzamide.
| Compound Name | 4-amino-3-[(6-chloro-1,3-benzothiazol-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 82775308 |
| Molecular Formula | C14H11ClN4OS |
| Molecular Weight | 318.79 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 4-amino-3-[(6-chloro-1,3-benzothiazol-2-yl)amino]benzamide |
| SMILES | NC(=O)c1ccc(N)c(Nc2nc3ccc(Cl)cc3s2)c1 |
| InChI | InChI=1S/C14H11ClN4OS/c15-8-2-4-10-12(6-8)21-14(18-10)19-11-5-7(13(17)20)1-3-9(11)16/h1-6H,16H2,(H2,17,20)(H,18,19) |
| InChIKey | HJRKPHAAMRYNOQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.79 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|