C19H27N3O4+2 — CID 6971616
ethyl 6-methoxy-4-(2-morpholin-4-ium-4-ylethylamino)quinolin-1-ium-3-carboxylate (PubChem CID 6971616) has the molecular formula C19H27N3O4+2 and a molecular weight of 361.44 g/mol. Its IUPAC name is ethyl 6-methoxy-4-(2-morpholin-4-ium-4-ylethylamino)quinolin-1-ium-3-carboxylate.
| Compound Name | ethyl 6-methoxy-4-(2-morpholin-4-ium-4-ylethylamino)quinolin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 6971616 |
| Molecular Formula | C19H27N3O4+2 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | ethyl 6-methoxy-4-(2-morpholin-4-ium-4-ylethylamino)quinolin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)c1c[nH+]c2ccc(OC)cc2c1NCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C19H25N3O4/c1-3-26-19(23)16-13-21-17-5-4-14(24-2)12-15(17)18(16)20-6-7-22-8-10-25-11-9-22/h4-5,12-13H,3,6-11H2,1-2H3,(H,20,21)/p+2 |
| InChIKey | KDTSDCRJCCLZQG-UHFFFAOYSA-P |
| XLogP | 0.17 |
| TPSA | 75.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |