C26H27N2O4+ — CID 6973336
ethyl 4-[2-(3,4-dimethoxyphenyl)ethylamino]benzo[h]quinolin-1-ium-3-carboxylate (PubChem CID 6973336) has the molecular formula C26H27N2O4+ and a molecular weight of 431.51 g/mol. Its IUPAC name is ethyl 4-[2-(3,4-dimethoxyphenyl)ethylamino]benzo[h]quinolin-1-ium-3-carboxylate.
| Compound Name | ethyl 4-[2-(3,4-dimethoxyphenyl)ethylamino]benzo[h]quinolin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 6973336 |
| Molecular Formula | C26H27N2O4+ |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | ethyl 4-[2-(3,4-dimethoxyphenyl)ethylamino]benzo[h]quinolin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)c1c[nH+]c2c(ccc3ccccc32)c1NCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C26H26N2O4/c1-4-32-26(29)21-16-28-24-19-8-6-5-7-18(19)10-11-20(24)25(21)27-14-13-17-9-12-22(30-2)23(15-17)31-3/h5-12,15-16H,4,13-14H2,1-3H3,(H,27,28)/p+1 |
| InChIKey | JAESXYCGWWKYKY-UHFFFAOYSA-O |
| XLogP | 4.66 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|