C23H26N3O3+ — CID 7130479
N-benzyl-6-[2-(3,4-dimethoxyphenyl)ethylamino]pyridin-1-ium-3-carboxamide (PubChem CID 7130479) has the molecular formula C23H26N3O3+ and a molecular weight of 392.48 g/mol. Its IUPAC name is N-benzyl-6-[2-(3,4-dimethoxyphenyl)ethylamino]pyridin-1-ium-3-carboxamide.
| Compound Name | N-benzyl-6-[2-(3,4-dimethoxyphenyl)ethylamino]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 7130479 |
| Molecular Formula | C23H26N3O3+ |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | N-benzyl-6-[2-(3,4-dimethoxyphenyl)ethylamino]pyridin-1-ium-3-carboxamide |
| SMILES | COc1ccc(CCNc2ccc(C(=O)NCc3ccccc3)c[nH+]2)cc1OC |
| InChI | InChI=1S/C23H25N3O3/c1-28-20-10-8-17(14-21(20)29-2)12-13-24-22-11-9-19(16-25-22)23(27)26-15-18-6-4-3-5-7-18/h3-11,14,16H,12-13,15H2,1-2H3,(H,24,25)(H,26,27)/p+1 |
| InChIKey | YGPQVKQVAVAOLE-UHFFFAOYSA-O |
| XLogP | 3.10 |
| TPSA | 73.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |