C20H20ClN2O2+ — CID 6973001
ethyl 4-(benzylamino)-7-chloro-8-methylquinolin-1-ium-3-carboxylate (PubChem CID 6973001) has the molecular formula C20H20ClN2O2+ and a molecular weight of 355.85 g/mol. Its IUPAC name is ethyl 4-(benzylamino)-7-chloro-8-methylquinolin-1-ium-3-carboxylate.
| Compound Name | ethyl 4-(benzylamino)-7-chloro-8-methylquinolin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 6973001 |
| Molecular Formula | C20H20ClN2O2+ |
| Molecular Weight | 355.85 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | ethyl 4-(benzylamino)-7-chloro-8-methylquinolin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)c1c[nH+]c2c(C)c(Cl)ccc2c1NCc1ccccc1 |
| InChI | InChI=1S/C20H19ClN2O2/c1-3-25-20(24)16-12-23-18-13(2)17(21)10-9-15(18)19(16)22-11-14-7-5-4-6-8-14/h4-10,12H,3,11H2,1-2H3,(H,22,23)/p+1 |
| InChIKey | NLDUMXQSIGKTBK-UHFFFAOYSA-O |
| XLogP | 4.40 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.85 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |