4-ethoxycarbonyl-3-methyl-1,2-oxazole-5-carboxylic acid

C8H9NO5 — CID 15692965

IUPAC4-ethoxycarbonyl-3-methyl-1,2-oxazole-5-carboxylic acid
SMILESCCOC(=O)c1c(C)noc1C(=O)O
InChIInChI=1S/C8H9NO5/c1-3-13-8(12)5-4(2)9-14-6(5)7(10)11/h3H2,1-2H3,(H,10,11)
InChIKeyDVFPZXGRQGKNMV-UHFFFAOYSA-N
MW199.16 g/mol
LogP0.86
Rot. Bonds3

About 4-ethoxycarbonyl-3-methyl-1,2-oxazole-5-carboxylic acid

4-ethoxycarbonyl-3-methyl-1,2-oxazole-5-carboxylic acid (PubChem CID 15692965) has the molecular formula C8H9NO5 and a molecular weight of 199.16 g/mol. Its IUPAC name is 4-ethoxycarbonyl-3-methyl-1,2-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name4-ethoxycarbonyl-3-methyl-1,2-oxazole-5-carboxylic acid
PubChem CID15692965
Molecular FormulaC8H9NO5
Molecular Weight199.16 g/mol
Exact Mass199.05
IUPAC Name4-ethoxycarbonyl-3-methyl-1,2-oxazole-5-carboxylic acid
SMILESCCOC(=O)c1c(C)noc1C(=O)O
InChIInChI=1S/C8H9NO5/c1-3-13-8(12)5-4(2)9-14-6(5)7(10)11/h3H2,1-2H3,(H,10,11)
InChIKeyDVFPZXGRQGKNMV-UHFFFAOYSA-N
XLogP0.86
TPSA89.63 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.16
LogP ≤ 50.86
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 4-ethoxycarbonyl-3-methyl-1,2-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-ethoxycarbonyl-3-methyl-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 4-ethoxycarbonyl-3-methyl-1,2-oxazole-5-carboxylic acid (CID 15692965) is 4-ethoxycarbonyl-3-methyl-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 4-ethoxycarbonyl-3-methyl-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 4-ethoxycarbonyl-3-methyl-1,2-oxazole-5-carboxylic acid is CCOC(=O)c1c(C)noc1C(=O)O.
What is the InChIKey of 4-ethoxycarbonyl-3-methyl-1,2-oxazole-5-carboxylic acid?
The InChIKey is DVFPZXGRQGKNMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO5/c1-3-13-8(12)5-4(2)9-14-6(5)7(10)11/h3H2,1-2H3,(H,10,11).
What are the key properties of 4-ethoxycarbonyl-3-methyl-1,2-oxazole-5-carboxylic acid?
4-ethoxycarbonyl-3-methyl-1,2-oxazole-5-carboxylic acid has a molecular weight of 199.16 g/mol, XLogP of 0.86, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxycarbonyl-3-methyl-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 15692965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).