C17H15F6N3O3 — CID 155559620
ethyl 5-[(E)-N-[3,5-bis(trifluoromethyl)anilino]-C-methylcarbonimidoyl]-3-methyl-1,2-oxazole-4-carboxylate (PubChem CID 155559620) has the molecular formula C17H15F6N3O3 and a molecular weight of 423.31 g/mol. Its IUPAC name is ethyl 5-[(E)-N-[3,5-bis(trifluoromethyl)anilino]-C-methylcarbonimidoyl]-3-methyl-1,2-oxazole-4-carboxylate.
| Compound Name | ethyl 5-[(E)-N-[3,5-bis(trifluoromethyl)anilino]-C-methylcarbonimidoyl]-3-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 155559620 |
| Molecular Formula | C17H15F6N3O3 |
| Molecular Weight | 423.31 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | ethyl 5-[(E)-N-[3,5-bis(trifluoromethyl)anilino]-C-methylcarbonimidoyl]-3-methyl-1,2-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C)noc1/C(C)=N/Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H15F6N3O3/c1-4-28-15(27)13-8(2)26-29-14(13)9(3)24-25-12-6-10(16(18,19)20)5-11(7-12)17(21,22)23/h5-7,25H,4H2,1-3H3/b24-9+ |
| InChIKey | FDIMLUSOYRGCLU-PGGKNCGUSA-N |
| XLogP | 5.03 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.31 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|