C21H15F6N3O3 — CID 139600181
5-benzyl-4-[(Z)-N-[3,5-bis(trifluoromethyl)anilino]-C-methylcarbonimidoyl]-1,2-oxazole-3-carboxylic acid (PubChem CID 139600181) has the molecular formula C21H15F6N3O3 and a molecular weight of 471.36 g/mol. Its IUPAC name is 5-benzyl-4-[(Z)-N-[3,5-bis(trifluoromethyl)anilino]-C-methylcarbonimidoyl]-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-benzyl-4-[(Z)-N-[3,5-bis(trifluoromethyl)anilino]-C-methylcarbonimidoyl]-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 139600181 |
| Molecular Formula | C21H15F6N3O3 |
| Molecular Weight | 471.36 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 5-benzyl-4-[(Z)-N-[3,5-bis(trifluoromethyl)anilino]-C-methylcarbonimidoyl]-1,2-oxazole-3-carboxylic acid |
| SMILES | C/C(=N/Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1c(C(=O)O)noc1Cc1ccccc1 |
| InChI | InChI=1S/C21H15F6N3O3/c1-11(17-16(33-30-18(17)19(31)32)7-12-5-3-2-4-6-12)28-29-15-9-13(20(22,23)24)8-14(10-15)21(25,26)27/h2-6,8-10,29H,7H2,1H3,(H,31,32)/b28-11- |
| InChIKey | JBGQWKQSSOCCDO-FXMZOFOKSA-N |
| XLogP | 5.84 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.36 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|