C12H13N3O — CID 11264385
N-[(Z)-1-(5-methyl-1,2-oxazol-3-yl)ethylideneamino]aniline (PubChem CID 11264385) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is N-[(Z)-1-(5-methyl-1,2-oxazol-3-yl)ethylideneamino]aniline.
| Compound Name | N-[(Z)-1-(5-methyl-1,2-oxazol-3-yl)ethylideneamino]aniline |
|---|---|
| PubChem CID | 11264385 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | N-[(Z)-1-(5-methyl-1,2-oxazol-3-yl)ethylideneamino]aniline |
| SMILES | C/C(=N/Nc1ccccc1)c1cc(C)on1 |
| InChI | InChI=1S/C12H13N3O/c1-9-8-12(15-16-9)10(2)13-14-11-6-4-3-5-7-11/h3-8,14H,1-2H3/b13-10- |
| InChIKey | UTQHHZXZGQZMNG-RAXLEYEMSA-N |
| XLogP | 2.82 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|