C25H25N7 — CID 78460794
4-N-(2,4-dimethylphenyl)-6-N-phenyl-2-N-(1-phenylethylideneamino)-1,3,5-triazine-2,4,6-triamine (PubChem CID 78460794) has the molecular formula C25H25N7 and a molecular weight of 423.52 g/mol. Its IUPAC name is 4-N-(2,4-dimethylphenyl)-6-N-phenyl-2-N-(1-phenylethylideneamino)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(2,4-dimethylphenyl)-6-N-phenyl-2-N-(1-phenylethylideneamino)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 78460794 |
| Molecular Formula | C25H25N7 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 4-N-(2,4-dimethylphenyl)-6-N-phenyl-2-N-(1-phenylethylideneamino)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CC(=NNc1nc(Nc2ccccc2)nc(Nc2ccc(C)cc2C)n1)c1ccccc1 |
| InChI | InChI=1S/C25H25N7/c1-17-14-15-22(18(2)16-17)27-24-28-23(26-21-12-8-5-9-13-21)29-25(30-24)32-31-19(3)20-10-6-4-7-11-20/h4-16H,1-3H3,(H3,26,27,28,29,30,32) |
| InChIKey | FQZXLNCNTJQGAG-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|