C25H24N8O2 — CID 46501140
4-N-(2,4-dimethylphenyl)-2-N-[(E)-1-(4-nitrophenyl)ethylideneamino]-6-N-phenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 46501140) has the molecular formula C25H24N8O2 and a molecular weight of 468.52 g/mol. Its IUPAC name is 4-N-(2,4-dimethylphenyl)-2-N-[(E)-1-(4-nitrophenyl)ethylideneamino]-6-N-phenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(2,4-dimethylphenyl)-2-N-[(E)-1-(4-nitrophenyl)ethylideneamino]-6-N-phenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 46501140 |
| Molecular Formula | C25H24N8O2 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 4-N-(2,4-dimethylphenyl)-2-N-[(E)-1-(4-nitrophenyl)ethylideneamino]-6-N-phenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | C/C(=N\Nc1nc(Nc2ccccc2)nc(Nc2ccc(C)cc2C)n1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H24N8O2/c1-16-9-14-22(17(2)15-16)27-24-28-23(26-20-7-5-4-6-8-20)29-25(30-24)32-31-18(3)19-10-12-21(13-11-19)33(34)35/h4-15H,1-3H3,(H3,26,27,28,29,30,32)/b31-18+ |
| InChIKey | APILYRAATCLJGX-FDAWAROLSA-N |
| XLogP | 5.72 |
| TPSA | 130.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|