C17H17F3N2O2 — CID 175792021
[2-[(1R)-1-aminoethyl]-3-benzyl-5-(trifluoromethyl)phenyl]carbamic acid (PubChem CID 175792021) has the molecular formula C17H17F3N2O2 and a molecular weight of 338.33 g/mol. Its IUPAC name is [2-[(1R)-1-aminoethyl]-3-benzyl-5-(trifluoromethyl)phenyl]carbamic acid.
| Compound Name | [2-[(1R)-1-aminoethyl]-3-benzyl-5-(trifluoromethyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 175792021 |
| Molecular Formula | C17H17F3N2O2 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | [2-[(1R)-1-aminoethyl]-3-benzyl-5-(trifluoromethyl)phenyl]carbamic acid |
| SMILES | C[C@@H](N)c1c(Cc2ccccc2)cc(C(F)(F)F)cc1NC(=O)O |
| InChI | InChI=1S/C17H17F3N2O2/c1-10(21)15-12(7-11-5-3-2-4-6-11)8-13(17(18,19)20)9-14(15)22-16(23)24/h2-6,8-10,22H,7,21H2,1H3,(H,23,24)/t10-/m1/s1 |
| InChIKey | BWDZNJPEXPWODR-SNVBAGLBSA-N |
| XLogP | 4.41 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |