C10H11F3N2O2 — CID 174207086
[3-[(1R)-1-aminoethyl]-5-(trifluoromethyl)phenyl]carbamic acid (PubChem CID 174207086) has the molecular formula C10H11F3N2O2 and a molecular weight of 248.20 g/mol. Its IUPAC name is [3-[(1R)-1-aminoethyl]-5-(trifluoromethyl)phenyl]carbamic acid.
| Compound Name | [3-[(1R)-1-aminoethyl]-5-(trifluoromethyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 174207086 |
| Molecular Formula | C10H11F3N2O2 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | [3-[(1R)-1-aminoethyl]-5-(trifluoromethyl)phenyl]carbamic acid |
| SMILES | C[C@@H](N)c1cc(NC(=O)O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H11F3N2O2/c1-5(14)6-2-7(10(11,12)13)4-8(3-6)15-9(16)17/h2-5,15H,14H2,1H3,(H,16,17)/t5-/m1/s1 |
| InChIKey | DCKIDWUPPVYLFA-RXMQYKEDSA-N |
| XLogP | 2.82 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |