C19H10ClF3N4O2 — CID 155045841
N-[3-chloro-5-(trifluoromethyl)anilino]-2-oxo-2-(5-phenyl-1,2-oxazol-3-yl)ethanimidoyl cyanide (PubChem CID 155045841) has the molecular formula C19H10ClF3N4O2 and a molecular weight of 418.76 g/mol. Its IUPAC name is N-[3-chloro-5-(trifluoromethyl)anilino]-2-oxo-2-(5-phenyl-1,2-oxazol-3-yl)ethanimidoyl cyanide.
| Compound Name | N-[3-chloro-5-(trifluoromethyl)anilino]-2-oxo-2-(5-phenyl-1,2-oxazol-3-yl)ethanimidoyl cyanide |
|---|---|
| PubChem CID | 155045841 |
| Molecular Formula | C19H10ClF3N4O2 |
| Molecular Weight | 418.76 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | N-[3-chloro-5-(trifluoromethyl)anilino]-2-oxo-2-(5-phenyl-1,2-oxazol-3-yl)ethanimidoyl cyanide |
| SMILES | N#CC(=NNc1cc(Cl)cc(C(F)(F)F)c1)C(=O)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C19H10ClF3N4O2/c20-13-6-12(19(21,22)23)7-14(8-13)25-26-16(10-24)18(28)15-9-17(29-27-15)11-4-2-1-3-5-11/h1-9,25H |
| InChIKey | FOPKSQDSROZHSX-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.76 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|