About ethyl 5-(aminomethyl)-3-methyl-1,2-oxazole-4-carboxylate
ethyl 5-(aminomethyl)-3-methyl-1,2-oxazole-4-carboxylate (PubChem CID 10103857) has the molecular formula C8H12N2O3
and a molecular weight of 184.19 g/mol. Its IUPAC name is ethyl 5-(aminomethyl)-3-methyl-1,2-oxazole-4-carboxylate.
Analyze ethyl 5-(aminomethyl)-3-methyl-1,2-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(aminomethyl)-3-methyl-1,2-oxazole-4-carboxylate?
The IUPAC name of ethyl 5-(aminomethyl)-3-methyl-1,2-oxazole-4-carboxylate (CID 10103857) is ethyl 5-(aminomethyl)-3-methyl-1,2-oxazole-4-carboxylate.
What is the SMILES notation for ethyl 5-(aminomethyl)-3-methyl-1,2-oxazole-4-carboxylate?
The canonical SMILES for ethyl 5-(aminomethyl)-3-methyl-1,2-oxazole-4-carboxylate is CCOC(=O)c1c(C)noc1CN.
What is the InChIKey of ethyl 5-(aminomethyl)-3-methyl-1,2-oxazole-4-carboxylate?
The InChIKey is LTTUAGKTDSMNQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O3/c1-3-12-8(11)7-5(2)10-13-6(7)4-9/h3-4,9H2,1-2H3.
What are the key properties of ethyl 5-(aminomethyl)-3-methyl-1,2-oxazole-4-carboxylate?
ethyl 5-(aminomethyl)-3-methyl-1,2-oxazole-4-carboxylate has a molecular weight of 184.19 g/mol, XLogP of 0.62, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(aminomethyl)-3-methyl-1,2-oxazole-4-carboxylate is sourced from PubChem (CID 10103857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).