C11H18NO6P — CID 71415665
ethyl 3-(diethoxyphosphorylmethyl)-1,2-oxazole-5-carboxylate (PubChem CID 71415665) has the molecular formula C11H18NO6P and a molecular weight of 291.24 g/mol. Its IUPAC name is ethyl 3-(diethoxyphosphorylmethyl)-1,2-oxazole-5-carboxylate.
| Compound Name | ethyl 3-(diethoxyphosphorylmethyl)-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 71415665 |
| Molecular Formula | C11H18NO6P |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | ethyl 3-(diethoxyphosphorylmethyl)-1,2-oxazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(CP(=O)(OCC)OCC)no1 |
| InChI | InChI=1S/C11H18NO6P/c1-4-15-11(13)10-7-9(12-18-10)8-19(14,16-5-2)17-6-3/h7H,4-6,8H2,1-3H3 |
| InChIKey | RKFZSPSIWBCDIG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 87.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|