C11H17O6P — CID 125492347
4-(diethoxyphosphorylmethyl)-5-methylfuran-2-carboxylic acid (PubChem CID 125492347) has the molecular formula C11H17O6P and a molecular weight of 276.22 g/mol. Its IUPAC name is 4-(diethoxyphosphorylmethyl)-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-(diethoxyphosphorylmethyl)-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 125492347 |
| Molecular Formula | C11H17O6P |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 4-(diethoxyphosphorylmethyl)-5-methylfuran-2-carboxylic acid |
| SMILES | CCOP(=O)(Cc1cc(C(=O)O)oc1C)OCC |
| InChI | InChI=1S/C11H17O6P/c1-4-15-18(14,16-5-2)7-9-6-10(11(12)13)17-8(9)3/h6H,4-5,7H2,1-3H3,(H,12,13) |
| InChIKey | VJXQBQWVLWPQHE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|