C30H19F6NO2 — CID 135030027
ethyl 4,5-dinaphthalen-1-yl-3,6-bis(trifluoromethyl)pyridine-2-carboxylate (PubChem CID 135030027) has the molecular formula C30H19F6NO2 and a molecular weight of 539.48 g/mol. Its IUPAC name is ethyl 4,5-dinaphthalen-1-yl-3,6-bis(trifluoromethyl)pyridine-2-carboxylate.
| Compound Name | ethyl 4,5-dinaphthalen-1-yl-3,6-bis(trifluoromethyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 135030027 |
| Molecular Formula | C30H19F6NO2 |
| Molecular Weight | 539.48 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | ethyl 4,5-dinaphthalen-1-yl-3,6-bis(trifluoromethyl)pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1nc(C(F)(F)F)c(-c2cccc3ccccc23)c(-c2cccc3ccccc23)c1C(F)(F)F |
| InChI | InChI=1S/C30H19F6NO2/c1-2-39-28(38)26-25(29(31,32)33)23(21-15-7-11-17-9-3-5-13-19(17)21)24(27(37-26)30(34,35)36)22-16-8-12-18-10-4-6-14-20(18)22/h3-16H,2H2,1H3 |
| InChIKey | YVUSNNAZYJEXDS-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.48 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |