About ethyl 1-[2-(diethylamino)-1,1-difluoro-2-oxoethyl]-4-phenylisoquinoline-3-carboxylate
ethyl 1-[2-(diethylamino)-1,1-difluoro-2-oxoethyl]-4-phenylisoquinoline-3-carboxylate (PubChem CID 141474129) has the molecular formula C24H24F2N2O3
and a molecular weight of 426.46 g/mol. Its IUPAC name is ethyl 1-[2-(diethylamino)-1,1-difluoro-2-oxoethyl]-4-phenylisoquinoline-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[2-(diethylamino)-1,1-difluoro-2-oxoethyl]-4-phenylisoquinoline-3-carboxylate |
| PubChem CID | 141474129 |
| Molecular Formula | C24H24F2N2O3 |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | ethyl 1-[2-(diethylamino)-1,1-difluoro-2-oxoethyl]-4-phenylisoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1nc(C(F)(F)C(=O)N(CC)CC)c2ccccc2c1-c1ccccc1 |
| InChI | InChI=1S/C24H24F2N2O3/c1-4-28(5-2)23(30)24(25,26)21-18-15-11-10-14-17(18)19(16-12-8-7-9-13-16)20(27-21)22(29)31-6-3/h7-15H,4-6H2,1-3H3 |
| InChIKey | WMXORTOMQKWBNI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 1-[2-(diethylamino)-1,1-difluoro-2-oxoethyl]-4-phenylisoquinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[2-(diethylamino)-1,1-difluoro-2-oxoethyl]-4-phenylisoquinoline-3-carboxylate?
The IUPAC name of ethyl 1-[2-(diethylamino)-1,1-difluoro-2-oxoethyl]-4-phenylisoquinoline-3-carboxylate (CID 141474129) is ethyl 1-[2-(diethylamino)-1,1-difluoro-2-oxoethyl]-4-phenylisoquinoline-3-carboxylate.
What is the SMILES notation for ethyl 1-[2-(diethylamino)-1,1-difluoro-2-oxoethyl]-4-phenylisoquinoline-3-carboxylate?
The canonical SMILES for ethyl 1-[2-(diethylamino)-1,1-difluoro-2-oxoethyl]-4-phenylisoquinoline-3-carboxylate is CCOC(=O)c1nc(C(F)(F)C(=O)N(CC)CC)c2ccccc2c1-c1ccccc1.
What is the InChIKey of ethyl 1-[2-(diethylamino)-1,1-difluoro-2-oxoethyl]-4-phenylisoquinoline-3-carboxylate?
The InChIKey is WMXORTOMQKWBNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24F2N2O3/c1-4-28(5-2)23(30)24(25,26)21-18-15-11-10-14-17(18)19(16-12-8-7-9-13-16)20(27-21)22(29)31-6-3/h7-15H,4-6H2,1-3H3.
What are the key properties of ethyl 1-[2-(diethylamino)-1,1-difluoro-2-oxoethyl]-4-phenylisoquinoline-3-carboxylate?
ethyl 1-[2-(diethylamino)-1,1-difluoro-2-oxoethyl]-4-phenylisoquinoline-3-carboxylate has a molecular weight of 426.46 g/mol, XLogP of 5.04, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[2-(diethylamino)-1,1-difluoro-2-oxoethyl]-4-phenylisoquinoline-3-carboxylate is sourced from PubChem (CID 141474129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).