C15H13ClF5NO4 — CID 174519418
methyl 5-(2-chloro-2-oxoacetyl)-2-(difluoromethyl)-4-(2-methylpropyl)-6-(trifluoromethyl)pyridine-3-carboxylate (PubChem CID 174519418) has the molecular formula C15H13ClF5NO4 and a molecular weight of 401.72 g/mol. Its IUPAC name is methyl 5-(2-chloro-2-oxoacetyl)-2-(difluoromethyl)-4-(2-methylpropyl)-6-(trifluoromethyl)pyridine-3-carboxylate.
| Compound Name | methyl 5-(2-chloro-2-oxoacetyl)-2-(difluoromethyl)-4-(2-methylpropyl)-6-(trifluoromethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 174519418 |
| Molecular Formula | C15H13ClF5NO4 |
| Molecular Weight | 401.72 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | methyl 5-(2-chloro-2-oxoacetyl)-2-(difluoromethyl)-4-(2-methylpropyl)-6-(trifluoromethyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(C(F)F)nc(C(F)(F)F)c(C(=O)C(=O)Cl)c1CC(C)C |
| InChI | InChI=1S/C15H13ClF5NO4/c1-5(2)4-6-7(14(25)26-3)9(13(17)18)22-11(15(19,20)21)8(6)10(23)12(16)24/h5,13H,4H2,1-3H3 |
| InChIKey | HTRXMKLCBYAQAU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.72 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|