C18H16F5N3O2S — CID 54502979
methyl 2-(difluoromethyl)-4-(2-methylpropyl)-5-(pyrimidine-2-carbothioyl)-6-(trifluoromethyl)pyridine-3-carboxylate (PubChem CID 54502979) has the molecular formula C18H16F5N3O2S and a molecular weight of 433.40 g/mol. Its IUPAC name is methyl 2-(difluoromethyl)-4-(2-methylpropyl)-5-(pyrimidine-2-carbothioyl)-6-(trifluoromethyl)pyridine-3-carboxylate.
| Compound Name | methyl 2-(difluoromethyl)-4-(2-methylpropyl)-5-(pyrimidine-2-carbothioyl)-6-(trifluoromethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 54502979 |
| Molecular Formula | C18H16F5N3O2S |
| Molecular Weight | 433.40 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | methyl 2-(difluoromethyl)-4-(2-methylpropyl)-5-(pyrimidine-2-carbothioyl)-6-(trifluoromethyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(C(F)F)nc(C(F)(F)F)c(C(=S)c2ncccn2)c1CC(C)C |
| InChI | InChI=1S/C18H16F5N3O2S/c1-8(2)7-9-10(17(27)28-3)12(15(19)20)26-14(18(21,22)23)11(9)13(29)16-24-5-4-6-25-16/h4-6,8,15H,7H2,1-3H3 |
| InChIKey | YDSXCFFQBBIBDE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|