C11H14N2O5 — CID 22224466
ethyl 3-(4-oxooxan-3-yl)oxy-1H-pyrazole-5-carboxylate (PubChem CID 22224466) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is ethyl 3-(4-oxooxan-3-yl)oxy-1H-pyrazole-5-carboxylate.
| Compound Name | ethyl 3-(4-oxooxan-3-yl)oxy-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 22224466 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | ethyl 3-(4-oxooxan-3-yl)oxy-1H-pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(OC2COCCC2=O)n[nH]1 |
| InChI | InChI=1S/C11H14N2O5/c1-2-17-11(15)7-5-10(13-12-7)18-9-6-16-4-3-8(9)14/h5,9H,2-4,6H2,1H3,(H,12,13) |
| InChIKey | UTTPNEWNHLRPMR-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 90.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |