C10H8BrNO3S — CID 115280369
ethyl 2-(5-bromofuran-2-yl)-1,3-thiazole-4-carboxylate (PubChem CID 115280369) has the molecular formula C10H8BrNO3S and a molecular weight of 302.15 g/mol. Its IUPAC name is ethyl 2-(5-bromofuran-2-yl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(5-bromofuran-2-yl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 115280369 |
| Molecular Formula | C10H8BrNO3S |
| Molecular Weight | 302.15 g/mol |
| Exact Mass | 300.94 |
| IUPAC Name | ethyl 2-(5-bromofuran-2-yl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(-c2ccc(Br)o2)n1 |
| InChI | InChI=1S/C10H8BrNO3S/c1-2-14-10(13)6-5-16-9(12-6)7-3-4-8(11)15-7/h3-5H,2H2,1H3 |
| InChIKey | ICRZMWMGSCZRFB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.15 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |