C22H21ClN4O — CID 30317879
2-anilino-4-(4-chloroanilino)-7,7-dimethyl-6,8-dihydroquinazolin-5-one (PubChem CID 30317879) has the molecular formula C22H21ClN4O and a molecular weight of 392.89 g/mol. Its IUPAC name is 2-anilino-4-(4-chloroanilino)-7,7-dimethyl-6,8-dihydroquinazolin-5-one.
| Compound Name | 2-anilino-4-(4-chloroanilino)-7,7-dimethyl-6,8-dihydroquinazolin-5-one |
|---|---|
| PubChem CID | 30317879 |
| Molecular Formula | C22H21ClN4O |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 2-anilino-4-(4-chloroanilino)-7,7-dimethyl-6,8-dihydroquinazolin-5-one |
| SMILES | CC1(C)CC(=O)c2c(nc(Nc3ccccc3)nc2Nc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C22H21ClN4O/c1-22(2)12-17-19(18(28)13-22)20(24-16-10-8-14(23)9-11-16)27-21(26-17)25-15-6-4-3-5-7-15/h3-11H,12-13H2,1-2H3,(H2,24,25,26,27) |
| InChIKey | VYWBMFUMIQHAOQ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |