C21H19ClN4O — CID 43902982
2-anilino-4-(4-chloroanilino)-7-methyl-7,8-dihydro-6H-quinazolin-5-one (PubChem CID 43902982) has the molecular formula C21H19ClN4O and a molecular weight of 378.86 g/mol. Its IUPAC name is 2-anilino-4-(4-chloroanilino)-7-methyl-7,8-dihydro-6H-quinazolin-5-one.
| Compound Name | 2-anilino-4-(4-chloroanilino)-7-methyl-7,8-dihydro-6H-quinazolin-5-one |
|---|---|
| PubChem CID | 43902982 |
| Molecular Formula | C21H19ClN4O |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2-anilino-4-(4-chloroanilino)-7-methyl-7,8-dihydro-6H-quinazolin-5-one |
| SMILES | CC1CC(=O)c2c(nc(Nc3ccccc3)nc2Nc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C21H19ClN4O/c1-13-11-17-19(18(27)12-13)20(23-16-9-7-14(22)8-10-16)26-21(25-17)24-15-5-3-2-4-6-15/h2-10,13H,11-12H2,1H3,(H2,23,24,25,26) |
| InChIKey | RWWGKTMLZLCSGQ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |