C13H10ClFN2O4S — CID 118560117
3-[(5-chloro-2-hydroxyphenyl)carbamoylamino]benzenesulfonyl fluoride (PubChem CID 118560117) has the molecular formula C13H10ClFN2O4S and a molecular weight of 344.75 g/mol. Its IUPAC name is 3-[(5-chloro-2-hydroxyphenyl)carbamoylamino]benzenesulfonyl fluoride.
| Compound Name | 3-[(5-chloro-2-hydroxyphenyl)carbamoylamino]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 118560117 |
| Molecular Formula | C13H10ClFN2O4S |
| Molecular Weight | 344.75 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 3-[(5-chloro-2-hydroxyphenyl)carbamoylamino]benzenesulfonyl fluoride |
| SMILES | O=C(Nc1cccc(S(=O)(=O)F)c1)Nc1cc(Cl)ccc1O |
| InChI | InChI=1S/C13H10ClFN2O4S/c14-8-4-5-12(18)11(6-8)17-13(19)16-9-2-1-3-10(7-9)22(15,20)21/h1-7,18H,(H2,16,17,19) |
| InChIKey | CMIIJVAKRIFODM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.75 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|