C12H10ClN3O2 — CID 108892711
1-(5-chloro-2-hydroxyphenyl)-3-pyridin-4-ylurea (PubChem CID 108892711) has the molecular formula C12H10ClN3O2 and a molecular weight of 263.68 g/mol. Its IUPAC name is 1-(5-chloro-2-hydroxyphenyl)-3-pyridin-4-ylurea.
| Compound Name | 1-(5-chloro-2-hydroxyphenyl)-3-pyridin-4-ylurea |
|---|---|
| PubChem CID | 108892711 |
| Molecular Formula | C12H10ClN3O2 |
| Molecular Weight | 263.68 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 1-(5-chloro-2-hydroxyphenyl)-3-pyridin-4-ylurea |
| SMILES | O=C(Nc1ccncc1)Nc1cc(Cl)ccc1O |
| InChI | InChI=1S/C12H10ClN3O2/c13-8-1-2-11(17)10(7-8)16-12(18)15-9-3-5-14-6-4-9/h1-7,17H,(H2,14,15,16,18) |
| InChIKey | AJBOYCXTFREFOA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.68 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|