C13H17ClN2O2 — CID 108914686
1-(5-chloro-2-hydroxyphenyl)-3-[(E)-2,3-dimethylbut-1-enyl]urea (PubChem CID 108914686) has the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. Its IUPAC name is 1-(5-chloro-2-hydroxyphenyl)-3-[(E)-2,3-dimethylbut-1-enyl]urea.
| Compound Name | 1-(5-chloro-2-hydroxyphenyl)-3-[(E)-2,3-dimethylbut-1-enyl]urea |
|---|---|
| PubChem CID | 108914686 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 1-(5-chloro-2-hydroxyphenyl)-3-[(E)-2,3-dimethylbut-1-enyl]urea |
| SMILES | C/C(=C\NC(=O)Nc1cc(Cl)ccc1O)C(C)C |
| InChI | InChI=1S/C13H17ClN2O2/c1-8(2)9(3)7-15-13(18)16-11-6-10(14)4-5-12(11)17/h4-8,17H,1-3H3,(H2,15,16,18)/b9-7+ |
| InChIKey | LTMARQHSCZTWJS-VQHVLOKHSA-N |
| XLogP | 3.73 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|