C10H13ClN2O2 — CID 120872763
3-amino-N-(5-chloro-2-hydroxyphenyl)butanamide (PubChem CID 120872763) has the molecular formula C10H13ClN2O2 and a molecular weight of 228.68 g/mol. Its IUPAC name is 3-amino-N-(5-chloro-2-hydroxyphenyl)butanamide.
| Compound Name | 3-amino-N-(5-chloro-2-hydroxyphenyl)butanamide |
|---|---|
| PubChem CID | 120872763 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 3-amino-N-(5-chloro-2-hydroxyphenyl)butanamide |
| SMILES | CC(N)CC(=O)Nc1cc(Cl)ccc1O |
| InChI | InChI=1S/C10H13ClN2O2/c1-6(12)4-10(15)13-8-5-7(11)2-3-9(8)14/h2-3,5-6,14H,4,12H2,1H3,(H,13,15) |
| InChIKey | ZWJRUIWVURYYTR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|