C20H24ClN3O3 — CID 174842970
(2S)-2-amino-N'-(5-chloro-2-hydroxyphenyl)-N-(3-phenylpropyl)pentanediamide (PubChem CID 174842970) has the molecular formula C20H24ClN3O3 and a molecular weight of 389.88 g/mol. Its IUPAC name is (2S)-2-amino-N'-(5-chloro-2-hydroxyphenyl)-N-(3-phenylpropyl)pentanediamide.
| Compound Name | (2S)-2-amino-N'-(5-chloro-2-hydroxyphenyl)-N-(3-phenylpropyl)pentanediamide |
|---|---|
| PubChem CID | 174842970 |
| Molecular Formula | C20H24ClN3O3 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | (2S)-2-amino-N'-(5-chloro-2-hydroxyphenyl)-N-(3-phenylpropyl)pentanediamide |
| SMILES | N[C@@H](CCC(=O)Nc1cc(Cl)ccc1O)C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C20H24ClN3O3/c21-15-8-10-18(25)17(13-15)24-19(26)11-9-16(22)20(27)23-12-4-7-14-5-2-1-3-6-14/h1-3,5-6,8,10,13,16,25H,4,7,9,11-12,22H2,(H,23,27)(H,24,26)/t16-/m0/s1 |
| InChIKey | BQRSFQZTBMVXAO-INIZCTEOSA-N |
| XLogP | 2.84 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|