C19H21Cl2N3O6S — CID 71542641
3-[[(4S)-4-amino-5-[2-(3-chlorophenyl)ethylamino]-5-oxopentanoyl]amino]-5-chloro-2-hydroxybenzenesulfonic acid (PubChem CID 71542641) has the molecular formula C19H21Cl2N3O6S and a molecular weight of 490.37 g/mol. Its IUPAC name is 3-[[(4S)-4-amino-5-[2-(3-chlorophenyl)ethylamino]-5-oxopentanoyl]amino]-5-chloro-2-hydroxybenzenesulfonic acid.
| Compound Name | 3-[[(4S)-4-amino-5-[2-(3-chlorophenyl)ethylamino]-5-oxopentanoyl]amino]-5-chloro-2-hydroxybenzenesulfonic acid |
|---|---|
| PubChem CID | 71542641 |
| Molecular Formula | C19H21Cl2N3O6S |
| Molecular Weight | 490.37 g/mol |
| Exact Mass | 489.05 |
| IUPAC Name | 3-[[(4S)-4-amino-5-[2-(3-chlorophenyl)ethylamino]-5-oxopentanoyl]amino]-5-chloro-2-hydroxybenzenesulfonic acid |
| SMILES | N[C@@H](CCC(=O)Nc1cc(Cl)cc(S(=O)(=O)O)c1O)C(=O)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H21Cl2N3O6S/c20-12-3-1-2-11(8-12)6-7-23-19(27)14(22)4-5-17(25)24-15-9-13(21)10-16(18(15)26)31(28,29)30/h1-3,8-10,14,26H,4-7,22H2,(H,23,27)(H,24,25)(H,28,29,30)/t14-/m0/s1 |
| InChIKey | MALJWUBSEFTRCS-AWEZNQCLSA-N |
| XLogP | 2.35 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|