C14H19ClN4O7S — CID 89449897
3-[[(4S)-4-amino-5-oxo-5-(2-propanoylhydrazinyl)pentanoyl]amino]-5-chloro-2-hydroxybenzenesulfonic acid (PubChem CID 89449897) has the molecular formula C14H19ClN4O7S and a molecular weight of 422.85 g/mol. Its IUPAC name is 3-[[(4S)-4-amino-5-oxo-5-(2-propanoylhydrazinyl)pentanoyl]amino]-5-chloro-2-hydroxybenzenesulfonic acid.
| Compound Name | 3-[[(4S)-4-amino-5-oxo-5-(2-propanoylhydrazinyl)pentanoyl]amino]-5-chloro-2-hydroxybenzenesulfonic acid |
|---|---|
| PubChem CID | 89449897 |
| Molecular Formula | C14H19ClN4O7S |
| Molecular Weight | 422.85 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 3-[[(4S)-4-amino-5-oxo-5-(2-propanoylhydrazinyl)pentanoyl]amino]-5-chloro-2-hydroxybenzenesulfonic acid |
| SMILES | CCC(=O)NNC(=O)[C@@H](N)CCC(=O)Nc1cc(Cl)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C14H19ClN4O7S/c1-2-11(20)18-19-14(23)8(16)3-4-12(21)17-9-5-7(15)6-10(13(9)22)27(24,25)26/h5-6,8,22H,2-4,16H2,1H3,(H,17,21)(H,18,20)(H,19,23)(H,24,25,26)/t8-/m0/s1 |
| InChIKey | KIFWTIIKGILIMV-QMMMGPOBSA-N |
| XLogP | -0.10 |
| TPSA | 187.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.85 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|