C11H12ClNO8S — CID 121268828
(2S)-2-[(5-chloro-2-hydroxy-3-sulfophenyl)carbamoyloxy]butanoic acid (PubChem CID 121268828) has the molecular formula C11H12ClNO8S and a molecular weight of 353.74 g/mol. Its IUPAC name is (2S)-2-[(5-chloro-2-hydroxy-3-sulfophenyl)carbamoyloxy]butanoic acid.
| Compound Name | (2S)-2-[(5-chloro-2-hydroxy-3-sulfophenyl)carbamoyloxy]butanoic acid |
|---|---|
| PubChem CID | 121268828 |
| Molecular Formula | C11H12ClNO8S |
| Molecular Weight | 353.74 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | (2S)-2-[(5-chloro-2-hydroxy-3-sulfophenyl)carbamoyloxy]butanoic acid |
| SMILES | CC[C@H](OC(=O)Nc1cc(Cl)cc(S(=O)(=O)O)c1O)C(=O)O |
| InChI | InChI=1S/C11H12ClNO8S/c1-2-7(10(15)16)21-11(17)13-6-3-5(12)4-8(9(6)14)22(18,19)20/h3-4,7,14H,2H2,1H3,(H,13,17)(H,15,16)(H,18,19,20)/t7-/m0/s1 |
| InChIKey | FDGFAQIOYACBME-ZETCQYMHSA-N |
| XLogP | 1.70 |
| TPSA | 150.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.74 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|