C21H25ClN2O6S — CID 157378185
3-[(5S)-5-amino-2,6-dioxo-6-(3-phenylpropylamino)hexyl]-5-chloro-2-hydroxybenzenesulfonic acid (PubChem CID 157378185) has the molecular formula C21H25ClN2O6S and a molecular weight of 468.96 g/mol. Its IUPAC name is 3-[(5S)-5-amino-2,6-dioxo-6-(3-phenylpropylamino)hexyl]-5-chloro-2-hydroxybenzenesulfonic acid.
| Compound Name | 3-[(5S)-5-amino-2,6-dioxo-6-(3-phenylpropylamino)hexyl]-5-chloro-2-hydroxybenzenesulfonic acid |
|---|---|
| PubChem CID | 157378185 |
| Molecular Formula | C21H25ClN2O6S |
| Molecular Weight | 468.96 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 3-[(5S)-5-amino-2,6-dioxo-6-(3-phenylpropylamino)hexyl]-5-chloro-2-hydroxybenzenesulfonic acid |
| SMILES | N[C@@H](CCC(=O)Cc1cc(Cl)cc(S(=O)(=O)O)c1O)C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C21H25ClN2O6S/c22-16-11-15(20(26)19(13-16)31(28,29)30)12-17(25)8-9-18(23)21(27)24-10-4-7-14-5-2-1-3-6-14/h1-3,5-6,11,13,18,26H,4,7-10,12,23H2,(H,24,27)(H,28,29,30)/t18-/m0/s1 |
| InChIKey | BKOGWNZIGVYXAY-SFHVURJKSA-N |
| XLogP | 2.26 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.96 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|