C16H21ClN2O7S — CID 159621241
3-[(5S)-5-amino-6-morpholin-4-yl-2,6-dioxohexyl]-5-chloro-2-hydroxybenzenesulfonic acid (PubChem CID 159621241) has the molecular formula C16H21ClN2O7S and a molecular weight of 420.87 g/mol. Its IUPAC name is 3-[(5S)-5-amino-6-morpholin-4-yl-2,6-dioxohexyl]-5-chloro-2-hydroxybenzenesulfonic acid.
| Compound Name | 3-[(5S)-5-amino-6-morpholin-4-yl-2,6-dioxohexyl]-5-chloro-2-hydroxybenzenesulfonic acid |
|---|---|
| PubChem CID | 159621241 |
| Molecular Formula | C16H21ClN2O7S |
| Molecular Weight | 420.87 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 3-[(5S)-5-amino-6-morpholin-4-yl-2,6-dioxohexyl]-5-chloro-2-hydroxybenzenesulfonic acid |
| SMILES | N[C@@H](CCC(=O)Cc1cc(Cl)cc(S(=O)(=O)O)c1O)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C16H21ClN2O7S/c17-11-7-10(15(21)14(9-11)27(23,24)25)8-12(20)1-2-13(18)16(22)19-3-5-26-6-4-19/h7,9,13,21H,1-6,8,18H2,(H,23,24,25)/t13-/m0/s1 |
| InChIKey | MNXKBZHYFAKQCP-ZDUSSCGKSA-N |
| XLogP | 0.37 |
| TPSA | 147.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.87 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|