C12H12Cl3NO2 — CID 62226501
2-chloro-2-(2,4-dichlorophenyl)-1-morpholin-4-ylethanone (PubChem CID 62226501) has the molecular formula C12H12Cl3NO2 and a molecular weight of 308.59 g/mol. Its IUPAC name is 2-chloro-2-(2,4-dichlorophenyl)-1-morpholin-4-ylethanone.
| Compound Name | 2-chloro-2-(2,4-dichlorophenyl)-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 62226501 |
| Molecular Formula | C12H12Cl3NO2 |
| Molecular Weight | 308.59 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | 2-chloro-2-(2,4-dichlorophenyl)-1-morpholin-4-ylethanone |
| SMILES | O=C(C(Cl)c1ccc(Cl)cc1Cl)N1CCOCC1 |
| InChI | InChI=1S/C12H12Cl3NO2/c13-8-1-2-9(10(14)7-8)11(15)12(17)16-3-5-18-6-4-16/h1-2,7,11H,3-6H2 |
| InChIKey | CKYTVMDAHPMBFT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.59 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|