About 3-[(2,4-dichlorophenyl)methylamino]-1-morpholin-4-yl-2-phenylpropan-1-one
3-[(2,4-dichlorophenyl)methylamino]-1-morpholin-4-yl-2-phenylpropan-1-one (PubChem CID 86893298) has the molecular formula C20H22Cl2N2O2
and a molecular weight of 393.31 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenyl)methylamino]-1-morpholin-4-yl-2-phenylpropan-1-one.
Molecular Properties
| Compound Name | 3-[(2,4-dichlorophenyl)methylamino]-1-morpholin-4-yl-2-phenylpropan-1-one |
| PubChem CID | 86893298 |
| Molecular Formula | C20H22Cl2N2O2 |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 3-[(2,4-dichlorophenyl)methylamino]-1-morpholin-4-yl-2-phenylpropan-1-one |
| SMILES | O=C(C(CNCc1ccc(Cl)cc1Cl)c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C20H22Cl2N2O2/c21-17-7-6-16(19(22)12-17)13-23-14-18(15-4-2-1-3-5-15)20(25)24-8-10-26-11-9-24/h1-7,12,18,23H,8-11,13-14H2 |
| InChIKey | MHRNTNKHFRUHEG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(2,4-dichlorophenyl)methylamino]-1-morpholin-4-yl-2-phenylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,4-dichlorophenyl)methylamino]-1-morpholin-4-yl-2-phenylpropan-1-one?
The IUPAC name of 3-[(2,4-dichlorophenyl)methylamino]-1-morpholin-4-yl-2-phenylpropan-1-one (CID 86893298) is 3-[(2,4-dichlorophenyl)methylamino]-1-morpholin-4-yl-2-phenylpropan-1-one.
What is the SMILES notation for 3-[(2,4-dichlorophenyl)methylamino]-1-morpholin-4-yl-2-phenylpropan-1-one?
The canonical SMILES for 3-[(2,4-dichlorophenyl)methylamino]-1-morpholin-4-yl-2-phenylpropan-1-one is O=C(C(CNCc1ccc(Cl)cc1Cl)c1ccccc1)N1CCOCC1.
What is the InChIKey of 3-[(2,4-dichlorophenyl)methylamino]-1-morpholin-4-yl-2-phenylpropan-1-one?
The InChIKey is MHRNTNKHFRUHEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22Cl2N2O2/c21-17-7-6-16(19(22)12-17)13-23-14-18(15-4-2-1-3-5-15)20(25)24-8-10-26-11-9-24/h1-7,12,18,23H,8-11,13-14H2.
What are the key properties of 3-[(2,4-dichlorophenyl)methylamino]-1-morpholin-4-yl-2-phenylpropan-1-one?
3-[(2,4-dichlorophenyl)methylamino]-1-morpholin-4-yl-2-phenylpropan-1-one has a molecular weight of 393.31 g/mol, XLogP of 3.73, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,4-dichlorophenyl)methylamino]-1-morpholin-4-yl-2-phenylpropan-1-one is sourced from PubChem (CID 86893298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).