C13H15Cl2NO3 — CID 95165980
(2S)-2-(3,5-dichlorophenoxy)-1-morpholin-4-ylpropan-1-one (PubChem CID 95165980) has the molecular formula C13H15Cl2NO3 and a molecular weight of 304.17 g/mol. Its IUPAC name is (2S)-2-(3,5-dichlorophenoxy)-1-morpholin-4-ylpropan-1-one.
| Compound Name | (2S)-2-(3,5-dichlorophenoxy)-1-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 95165980 |
| Molecular Formula | C13H15Cl2NO3 |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | (2S)-2-(3,5-dichlorophenoxy)-1-morpholin-4-ylpropan-1-one |
| SMILES | C[C@H](Oc1cc(Cl)cc(Cl)c1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C13H15Cl2NO3/c1-9(13(17)16-2-4-18-5-3-16)19-12-7-10(14)6-11(15)8-12/h6-9H,2-5H2,1H3/t9-/m0/s1 |
| InChIKey | OHVDDJQMUKKYGX-VIFPVBQESA-N |
| XLogP | 2.62 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |