C14H16Cl2N2O3 — CID 99773786
1-[(2S)-2-(3,5-dichlorophenoxy)propanoyl]-1,4-diazepan-5-one (PubChem CID 99773786) has the molecular formula C14H16Cl2N2O3 and a molecular weight of 331.20 g/mol. Its IUPAC name is 1-[(2S)-2-(3,5-dichlorophenoxy)propanoyl]-1,4-diazepan-5-one.
| Compound Name | 1-[(2S)-2-(3,5-dichlorophenoxy)propanoyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 99773786 |
| Molecular Formula | C14H16Cl2N2O3 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 1-[(2S)-2-(3,5-dichlorophenoxy)propanoyl]-1,4-diazepan-5-one |
| SMILES | C[C@H](Oc1cc(Cl)cc(Cl)c1)C(=O)N1CCNC(=O)CC1 |
| InChI | InChI=1S/C14H16Cl2N2O3/c1-9(21-12-7-10(15)6-11(16)8-12)14(20)18-4-2-13(19)17-3-5-18/h6-9H,2-5H2,1H3,(H,17,19)/t9-/m0/s1 |
| InChIKey | NQWZPJVCVWTZKF-VIFPVBQESA-N |
| XLogP | 2.11 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |