C19H22ClN3O6S — CID 89346520
5-chloro-3-[(2S)-2,5-diamino-1,5-dioxo-1-(2-phenylethylamino)pentan-3-yl]-2-hydroxybenzenesulfonic acid (PubChem CID 89346520) has the molecular formula C19H22ClN3O6S and a molecular weight of 455.92 g/mol. Its IUPAC name is 5-chloro-3-[(2S)-2,5-diamino-1,5-dioxo-1-(2-phenylethylamino)pentan-3-yl]-2-hydroxybenzenesulfonic acid.
| Compound Name | 5-chloro-3-[(2S)-2,5-diamino-1,5-dioxo-1-(2-phenylethylamino)pentan-3-yl]-2-hydroxybenzenesulfonic acid |
|---|---|
| PubChem CID | 89346520 |
| Molecular Formula | C19H22ClN3O6S |
| Molecular Weight | 455.92 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | 5-chloro-3-[(2S)-2,5-diamino-1,5-dioxo-1-(2-phenylethylamino)pentan-3-yl]-2-hydroxybenzenesulfonic acid |
| SMILES | NC(=O)CC(c1cc(Cl)cc(S(=O)(=O)O)c1O)[C@H](N)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C19H22ClN3O6S/c20-12-8-14(18(25)15(9-12)30(27,28)29)13(10-16(21)24)17(22)19(26)23-7-6-11-4-2-1-3-5-11/h1-5,8-9,13,17,25H,6-7,10,22H2,(H2,21,24)(H,23,26)(H,27,28,29)/t13?,17-/m0/s1 |
| InChIKey | JFGBBNCTBOQBGP-RUINGEJQSA-N |
| XLogP | 0.94 |
| TPSA | 172.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.92 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|