C16H19ClN2O2 — CID 67642182
2-amino-2-(2-hydroxyphenyl)-N-(2-phenylethyl)acetamide;hydrochloride (PubChem CID 67642182) has the molecular formula C16H19ClN2O2 and a molecular weight of 306.79 g/mol. Its IUPAC name is 2-amino-2-(2-hydroxyphenyl)-N-(2-phenylethyl)acetamide;hydrochloride.
| Compound Name | 2-amino-2-(2-hydroxyphenyl)-N-(2-phenylethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 67642182 |
| Molecular Formula | C16H19ClN2O2 |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 2-amino-2-(2-hydroxyphenyl)-N-(2-phenylethyl)acetamide;hydrochloride |
| SMILES | Cl.NC(C(=O)NCCc1ccccc1)c1ccccc1O |
| InChI | InChI=1S/C16H18N2O2.ClH/c17-15(13-8-4-5-9-14(13)19)16(20)18-11-10-12-6-2-1-3-7-12;/h1-9,15,19H,10-11,17H2,(H,18,20);1H |
| InChIKey | LEMRJQLKOHZWTH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|